C25H32O4S — CID 90029356
2-methyl-4-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfonyl]ethyl]benzoic acid (PubChem CID 90029356) has the molecular formula C25H32O4S and a molecular weight of 428.59 g/mol. Its IUPAC name is 2-methyl-4-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfonyl]ethyl]benzoic acid.
| Compound Name | 2-methyl-4-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfonyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 90029356 |
| Molecular Formula | C25H32O4S |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-methyl-4-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfonyl]ethyl]benzoic acid |
| SMILES | Cc1cc(CCS(=O)(=O)c2cc3c(cc2C)C(C)(C)CCC3(C)C)ccc1C(=O)O |
| InChI | InChI=1S/C25H32O4S/c1-16-13-18(7-8-19(16)23(26)27)9-12-30(28,29)22-15-21-20(14-17(22)2)24(3,4)10-11-25(21,5)6/h7-8,13-15H,9-12H2,1-6H3,(H,26,27) |
| InChIKey | GRSBVWUXFPPGBB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |