About 3-(4-ethyl-5-phenyl-1,2-oxazol-3-yl)phenol
3-(4-ethyl-5-phenyl-1,2-oxazol-3-yl)phenol (PubChem CID 90029446) has the molecular formula C17H15NO2
and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-(4-ethyl-5-phenyl-1,2-oxazol-3-yl)phenol.
Molecular Properties
| Compound Name | 3-(4-ethyl-5-phenyl-1,2-oxazol-3-yl)phenol |
| PubChem CID | 90029446 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-(4-ethyl-5-phenyl-1,2-oxazol-3-yl)phenol |
| SMILES | CCc1c(-c2cccc(O)c2)noc1-c1ccccc1 |
| InChI | InChI=1S/C17H15NO2/c1-2-15-16(13-9-6-10-14(19)11-13)18-20-17(15)12-7-4-3-5-8-12/h3-11,19H,2H2,1H3 |
| InChIKey | MAKADWGFVKBEAN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-ethyl-5-phenyl-1,2-oxazol-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-ethyl-5-phenyl-1,2-oxazol-3-yl)phenol?
The IUPAC name of 3-(4-ethyl-5-phenyl-1,2-oxazol-3-yl)phenol (CID 90029446) is 3-(4-ethyl-5-phenyl-1,2-oxazol-3-yl)phenol.
What is the SMILES notation for 3-(4-ethyl-5-phenyl-1,2-oxazol-3-yl)phenol?
The canonical SMILES for 3-(4-ethyl-5-phenyl-1,2-oxazol-3-yl)phenol is CCc1c(-c2cccc(O)c2)noc1-c1ccccc1.
What is the InChIKey of 3-(4-ethyl-5-phenyl-1,2-oxazol-3-yl)phenol?
The InChIKey is MAKADWGFVKBEAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2/c1-2-15-16(13-9-6-10-14(19)11-13)18-20-17(15)12-7-4-3-5-8-12/h3-11,19H,2H2,1H3.
What are the key properties of 3-(4-ethyl-5-phenyl-1,2-oxazol-3-yl)phenol?
3-(4-ethyl-5-phenyl-1,2-oxazol-3-yl)phenol has a molecular weight of 265.31 g/mol, XLogP of 4.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-ethyl-5-phenyl-1,2-oxazol-3-yl)phenol is sourced from PubChem (CID 90029446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).