About 1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol
1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol (PubChem CID 90029496) has the molecular formula C13H13F3N2O
and a molecular weight of 270.25 g/mol. Its IUPAC name is 1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol.
Molecular Properties
| Compound Name | 1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol |
| PubChem CID | 90029496 |
| Molecular Formula | C13H13F3N2O |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol |
| SMILES | Cc1nn(Cc2ccccc2)cc1C(O)C(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O/c1-9-11(12(19)13(14,15)16)8-18(17-9)7-10-5-3-2-4-6-10/h2-6,8,12,19H,7H2,1H3 |
| InChIKey | QFCDTKVNQXNFCH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol?
The IUPAC name of 1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol (CID 90029496) is 1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol.
What is the SMILES notation for 1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol?
The canonical SMILES for 1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol is Cc1nn(Cc2ccccc2)cc1C(O)C(F)(F)F.
What is the InChIKey of 1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol?
The InChIKey is QFCDTKVNQXNFCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3N2O/c1-9-11(12(19)13(14,15)16)8-18(17-9)7-10-5-3-2-4-6-10/h2-6,8,12,19H,7H2,1H3.
What are the key properties of 1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol?
1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol has a molecular weight of 270.25 g/mol, XLogP of 2.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol is sourced from PubChem (CID 90029496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).