About 4-[[5-[1-(2,3-dimethylphenyl)-3-iodopyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile
4-[[5-[1-(2,3-dimethylphenyl)-3-iodopyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile (PubChem CID 90030244) has the molecular formula C20H16IN7
and a molecular weight of 481.30 g/mol. Its IUPAC name is 4-[[5-[1-(2,3-dimethylphenyl)-3-iodopyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[5-[1-(2,3-dimethylphenyl)-3-iodopyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile |
| PubChem CID | 90030244 |
| Molecular Formula | C20H16IN7 |
| Molecular Weight | 481.30 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | 4-[[5-[1-(2,3-dimethylphenyl)-3-iodopyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile |
| SMILES | Cc1cccc(-n2cc(-c3nnn(Cc4ccc(C#N)cc4)n3)c(I)n2)c1C |
| InChI | InChI=1S/C20H16IN7/c1-13-4-3-5-18(14(13)2)27-12-17(19(21)24-27)20-23-26-28(25-20)11-16-8-6-15(10-22)7-9-16/h3-9,12H,11H2,1-2H3 |
| InChIKey | WXOSURQRFIJLHL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 85.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[[5-[1-(2,3-dimethylphenyl)-3-iodopyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-[1-(2,3-dimethylphenyl)-3-iodopyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile?
The IUPAC name of 4-[[5-[1-(2,3-dimethylphenyl)-3-iodopyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile (CID 90030244) is 4-[[5-[1-(2,3-dimethylphenyl)-3-iodopyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile.
What is the SMILES notation for 4-[[5-[1-(2,3-dimethylphenyl)-3-iodopyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile?
The canonical SMILES for 4-[[5-[1-(2,3-dimethylphenyl)-3-iodopyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile is Cc1cccc(-n2cc(-c3nnn(Cc4ccc(C#N)cc4)n3)c(I)n2)c1C.
What is the InChIKey of 4-[[5-[1-(2,3-dimethylphenyl)-3-iodopyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile?
The InChIKey is WXOSURQRFIJLHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16IN7/c1-13-4-3-5-18(14(13)2)27-12-17(19(21)24-27)20-23-26-28(25-20)11-16-8-6-15(10-22)7-9-16/h3-9,12H,11H2,1-2H3.
What are the key properties of 4-[[5-[1-(2,3-dimethylphenyl)-3-iodopyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile?
4-[[5-[1-(2,3-dimethylphenyl)-3-iodopyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile has a molecular weight of 481.30 g/mol, XLogP of 3.67, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-[1-(2,3-dimethylphenyl)-3-iodopyrazol-4-yl]tetrazol-2-yl]methyl]benzonitrile is sourced from PubChem (CID 90030244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).