C9H11N5O2S — CID 90030309
1-(3-methylsulfonylphenyl)-1,2,4-triazole-3,5-diamine (PubChem CID 90030309) has the molecular formula C9H11N5O2S and a molecular weight of 253.29 g/mol. Its IUPAC name is 1-(3-methylsulfonylphenyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(3-methylsulfonylphenyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 90030309 |
| Molecular Formula | C9H11N5O2S |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 1-(3-methylsulfonylphenyl)-1,2,4-triazole-3,5-diamine |
| SMILES | CS(=O)(=O)c1cccc(-n2nc(N)nc2N)c1 |
| InChI | InChI=1S/C9H11N5O2S/c1-17(15,16)7-4-2-3-6(5-7)14-9(11)12-8(10)13-14/h2-5H,1H3,(H4,10,11,12,13) |
| InChIKey | IRHARRWXHPNDFS-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |