About ethyl 1-benzyl-5,5-difluoro-4-hydroxy-2,6-dihydropyridine-3-carboxylate;oxolane
ethyl 1-benzyl-5,5-difluoro-4-hydroxy-2,6-dihydropyridine-3-carboxylate;oxolane (PubChem CID 90030612) has the molecular formula C19H25F2NO4
and a molecular weight of 369.41 g/mol. Its IUPAC name is ethyl 1-benzyl-5,5-difluoro-4-hydroxy-2,6-dihydropyridine-3-carboxylate;oxolane.
Molecular Properties
| Compound Name | ethyl 1-benzyl-5,5-difluoro-4-hydroxy-2,6-dihydropyridine-3-carboxylate;oxolane |
| PubChem CID | 90030612 |
| Molecular Formula | C19H25F2NO4 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | ethyl 1-benzyl-5,5-difluoro-4-hydroxy-2,6-dihydropyridine-3-carboxylate;oxolane |
| SMILES | C1CCOC1.CCOC(=O)C1=C(O)C(F)(F)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C15H17F2NO3.C4H8O/c1-2-21-14(20)12-9-18(10-15(16,17)13(12)19)8-11-6-4-3-5-7-11;1-2-4-5-3-1/h3-7,19H,2,8-10H2,1H3;1-4H2 |
| InChIKey | VXFDUBXCMLYUJP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-benzyl-5,5-difluoro-4-hydroxy-2,6-dihydropyridine-3-carboxylate;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-benzyl-5,5-difluoro-4-hydroxy-2,6-dihydropyridine-3-carboxylate;oxolane?
The IUPAC name of ethyl 1-benzyl-5,5-difluoro-4-hydroxy-2,6-dihydropyridine-3-carboxylate;oxolane (CID 90030612) is ethyl 1-benzyl-5,5-difluoro-4-hydroxy-2,6-dihydropyridine-3-carboxylate;oxolane.
What is the SMILES notation for ethyl 1-benzyl-5,5-difluoro-4-hydroxy-2,6-dihydropyridine-3-carboxylate;oxolane?
The canonical SMILES for ethyl 1-benzyl-5,5-difluoro-4-hydroxy-2,6-dihydropyridine-3-carboxylate;oxolane is C1CCOC1.CCOC(=O)C1=C(O)C(F)(F)CN(Cc2ccccc2)C1.
What is the InChIKey of ethyl 1-benzyl-5,5-difluoro-4-hydroxy-2,6-dihydropyridine-3-carboxylate;oxolane?
The InChIKey is VXFDUBXCMLYUJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2NO3.C4H8O/c1-2-21-14(20)12-9-18(10-15(16,17)13(12)19)8-11-6-4-3-5-7-11;1-2-4-5-3-1/h3-7,19H,2,8-10H2,1H3;1-4H2.
What are the key properties of ethyl 1-benzyl-5,5-difluoro-4-hydroxy-2,6-dihydropyridine-3-carboxylate;oxolane?
ethyl 1-benzyl-5,5-difluoro-4-hydroxy-2,6-dihydropyridine-3-carboxylate;oxolane has a molecular weight of 369.41 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-benzyl-5,5-difluoro-4-hydroxy-2,6-dihydropyridine-3-carboxylate;oxolane is sourced from PubChem (CID 90030612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).