C15H26N4O4 — CID 90030677
3,3-dimethyl-2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid (PubChem CID 90030677) has the molecular formula C15H26N4O4 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3,3-dimethyl-2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 90030677 |
| Molecular Formula | C15H26N4O4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 3,3-dimethyl-2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)C1(C)NC(=O)N(CN2CCNCC2)C1=O |
| InChI | InChI=1S/C15H26N4O4/c1-14(2,3)10(11(20)21)15(4)12(22)19(13(23)17-15)9-18-7-5-16-6-8-18/h10,16H,5-9H2,1-4H3,(H,17,23)(H,20,21) |
| InChIKey | MEULNDNTTFHMSO-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|