C24H17F2N5O4 — CID 90030816
4-[11-(2,6-difluoro-3,5-dimethoxyphenyl)-4,12-dioxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-trien-13-yl]benzonitrile (PubChem CID 90030816) has the molecular formula C24H17F2N5O4 and a molecular weight of 477.43 g/mol. Its IUPAC name is 4-[11-(2,6-difluoro-3,5-dimethoxyphenyl)-4,12-dioxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-trien-13-yl]benzonitrile.
| Compound Name | 4-[11-(2,6-difluoro-3,5-dimethoxyphenyl)-4,12-dioxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-trien-13-yl]benzonitrile |
|---|---|
| PubChem CID | 90030816 |
| Molecular Formula | C24H17F2N5O4 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 4-[11-(2,6-difluoro-3,5-dimethoxyphenyl)-4,12-dioxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-trien-13-yl]benzonitrile |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4c(c3N(c3ccc(C#N)cc3)C2=O)CC(=O)N4)c1F |
| InChI | InChI=1S/C24H17F2N5O4/c1-34-16-8-17(35-2)20(26)22(19(16)25)30-11-13-10-28-23-15(7-18(32)29-23)21(13)31(24(30)33)14-5-3-12(9-27)4-6-14/h3-6,8,10H,7,11H2,1-2H3,(H,28,29,32) |
| InChIKey | ZEALNXGKDNCEDZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |