C8H8BrF2N5 — CID 90030842
3-(4-bromo-3,5-difluorophenyl)-1,2-dihydro-1,2,4-triazole-3,5-diamine (PubChem CID 90030842) has the molecular formula C8H8BrF2N5 and a molecular weight of 292.09 g/mol. Its IUPAC name is 3-(4-bromo-3,5-difluorophenyl)-1,2-dihydro-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-(4-bromo-3,5-difluorophenyl)-1,2-dihydro-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 90030842 |
| Molecular Formula | C8H8BrF2N5 |
| Molecular Weight | 292.09 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 3-(4-bromo-3,5-difluorophenyl)-1,2-dihydro-1,2,4-triazole-3,5-diamine |
| SMILES | NC1=NC(N)(c2cc(F)c(Br)c(F)c2)NN1 |
| InChI | InChI=1S/C8H8BrF2N5/c9-6-4(10)1-3(2-5(6)11)8(13)14-7(12)15-16-8/h1-2,16H,13H2,(H3,12,14,15) |
| InChIKey | UAWSLVCAUQUOOA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.09 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|