C9H8F3N5O2S — CID 90031012
1-[4-(trifluoromethylsulfonyl)phenyl]-1,2,4-triazole-3,5-diamine (PubChem CID 90031012) has the molecular formula C9H8F3N5O2S and a molecular weight of 307.26 g/mol. Its IUPAC name is 1-[4-(trifluoromethylsulfonyl)phenyl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-[4-(trifluoromethylsulfonyl)phenyl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 90031012 |
| Molecular Formula | C9H8F3N5O2S |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 1-[4-(trifluoromethylsulfonyl)phenyl]-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(N)n(-c2ccc(S(=O)(=O)C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C9H8F3N5O2S/c10-9(11,12)20(18,19)6-3-1-5(2-4-6)17-8(14)15-7(13)16-17/h1-4H,(H4,13,14,15,16) |
| InChIKey | PALFMMFABDHECP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |