About 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)benzene-1,3-dicarbonitrile
4,5-dihydroxy-2-(naphthalen-1-ylmethyl)benzene-1,3-dicarbonitrile (PubChem CID 90031847) has the molecular formula C19H12N2O2
and a molecular weight of 300.32 g/mol. Its IUPAC name is 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)benzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)benzene-1,3-dicarbonitrile |
| PubChem CID | 90031847 |
| Molecular Formula | C19H12N2O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(O)c(O)c(C#N)c1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C19H12N2O2/c20-10-14-9-18(22)19(23)17(11-21)16(14)8-13-6-3-5-12-4-1-2-7-15(12)13/h1-7,9,22-23H,8H2 |
| InChIKey | YSEAMGZGKGDIAY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)benzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)benzene-1,3-dicarbonitrile?
The IUPAC name of 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)benzene-1,3-dicarbonitrile (CID 90031847) is 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)benzene-1,3-dicarbonitrile.
What is the SMILES notation for 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)benzene-1,3-dicarbonitrile?
The canonical SMILES for 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)benzene-1,3-dicarbonitrile is N#Cc1cc(O)c(O)c(C#N)c1Cc1cccc2ccccc12.
What is the InChIKey of 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)benzene-1,3-dicarbonitrile?
The InChIKey is YSEAMGZGKGDIAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12N2O2/c20-10-14-9-18(22)19(23)17(11-21)16(14)8-13-6-3-5-12-4-1-2-7-15(12)13/h1-7,9,22-23H,8H2.
What are the key properties of 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)benzene-1,3-dicarbonitrile?
4,5-dihydroxy-2-(naphthalen-1-ylmethyl)benzene-1,3-dicarbonitrile has a molecular weight of 300.32 g/mol, XLogP of 3.59, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroxy-2-(naphthalen-1-ylmethyl)benzene-1,3-dicarbonitrile is sourced from PubChem (CID 90031847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).