C25H26N6O — CID 90032171
1-[4-(benzylamino)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl]-N,2-dimethylindole-4-carboxamide (PubChem CID 90032171) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is 1-[4-(benzylamino)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl]-N,2-dimethylindole-4-carboxamide.
| Compound Name | 1-[4-(benzylamino)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl]-N,2-dimethylindole-4-carboxamide |
|---|---|
| PubChem CID | 90032171 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 1-[4-(benzylamino)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl]-N,2-dimethylindole-4-carboxamide |
| SMILES | CNC(=O)c1cccc2c1cc(C)n2-c1nc2c(c(NCc3ccccc3)n1)CNCC2 |
| InChI | InChI=1S/C25H26N6O/c1-16-13-19-18(24(32)26-2)9-6-10-22(19)31(16)25-29-21-11-12-27-15-20(21)23(30-25)28-14-17-7-4-3-5-8-17/h3-10,13,27H,11-12,14-15H2,1-2H3,(H,26,32)(H,28,29,30) |
| InChIKey | DXOUBXJQSUHERC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |