About 3-(1-azidopropyl)-8-chloro-2-(3-fluorophenyl)pyrrolo[1,2-a]pyrazin-1-one
3-(1-azidopropyl)-8-chloro-2-(3-fluorophenyl)pyrrolo[1,2-a]pyrazin-1-one (PubChem CID 90032290) has the molecular formula C16H13ClFN5O
and a molecular weight of 345.77 g/mol. Its IUPAC name is 3-(1-azidopropyl)-8-chloro-2-(3-fluorophenyl)pyrrolo[1,2-a]pyrazin-1-one.
Molecular Properties
| Compound Name | 3-(1-azidopropyl)-8-chloro-2-(3-fluorophenyl)pyrrolo[1,2-a]pyrazin-1-one |
| PubChem CID | 90032290 |
| Molecular Formula | C16H13ClFN5O |
| Molecular Weight | 345.77 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 3-(1-azidopropyl)-8-chloro-2-(3-fluorophenyl)pyrrolo[1,2-a]pyrazin-1-one |
| SMILES | CCC(N=[N+]=[N-])c1cn2ccc(Cl)c2c(=O)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C16H13ClFN5O/c1-2-13(20-21-19)14-9-22-7-6-12(17)15(22)16(24)23(14)11-5-3-4-10(18)8-11/h3-9,13H,2H2,1H3 |
| InChIKey | YRAMDLHSUPRXQM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.77 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-azidopropyl)-8-chloro-2-(3-fluorophenyl)pyrrolo[1,2-a]pyrazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-azidopropyl)-8-chloro-2-(3-fluorophenyl)pyrrolo[1,2-a]pyrazin-1-one?
The IUPAC name of 3-(1-azidopropyl)-8-chloro-2-(3-fluorophenyl)pyrrolo[1,2-a]pyrazin-1-one (CID 90032290) is 3-(1-azidopropyl)-8-chloro-2-(3-fluorophenyl)pyrrolo[1,2-a]pyrazin-1-one.
What is the SMILES notation for 3-(1-azidopropyl)-8-chloro-2-(3-fluorophenyl)pyrrolo[1,2-a]pyrazin-1-one?
The canonical SMILES for 3-(1-azidopropyl)-8-chloro-2-(3-fluorophenyl)pyrrolo[1,2-a]pyrazin-1-one is CCC(N=[N+]=[N-])c1cn2ccc(Cl)c2c(=O)n1-c1cccc(F)c1.
What is the InChIKey of 3-(1-azidopropyl)-8-chloro-2-(3-fluorophenyl)pyrrolo[1,2-a]pyrazin-1-one?
The InChIKey is YRAMDLHSUPRXQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClFN5O/c1-2-13(20-21-19)14-9-22-7-6-12(17)15(22)16(24)23(14)11-5-3-4-10(18)8-11/h3-9,13H,2H2,1H3.
What are the key properties of 3-(1-azidopropyl)-8-chloro-2-(3-fluorophenyl)pyrrolo[1,2-a]pyrazin-1-one?
3-(1-azidopropyl)-8-chloro-2-(3-fluorophenyl)pyrrolo[1,2-a]pyrazin-1-one has a molecular weight of 345.77 g/mol, XLogP of 4.64, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-azidopropyl)-8-chloro-2-(3-fluorophenyl)pyrrolo[1,2-a]pyrazin-1-one is sourced from PubChem (CID 90032290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).