About dodecan-3-ylsulfanyl 2-methylpropanoate
dodecan-3-ylsulfanyl 2-methylpropanoate (PubChem CID 90032469) has the molecular formula C16H32O2S
and a molecular weight of 288.50 g/mol. Its IUPAC name is dodecan-3-ylsulfanyl 2-methylpropanoate.
Molecular Properties
| Compound Name | dodecan-3-ylsulfanyl 2-methylpropanoate |
| PubChem CID | 90032469 |
| Molecular Formula | C16H32O2S |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | dodecan-3-ylsulfanyl 2-methylpropanoate |
| SMILES | CCCCCCCCCC(CC)SOC(=O)C(C)C |
| InChI | InChI=1S/C16H32O2S/c1-5-7-8-9-10-11-12-13-15(6-2)19-18-16(17)14(3)4/h14-15H,5-13H2,1-4H3 |
| InChIKey | LUCQVIZVKPGLLL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dodecan-3-ylsulfanyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecan-3-ylsulfanyl 2-methylpropanoate?
The IUPAC name of dodecan-3-ylsulfanyl 2-methylpropanoate (CID 90032469) is dodecan-3-ylsulfanyl 2-methylpropanoate.
What is the SMILES notation for dodecan-3-ylsulfanyl 2-methylpropanoate?
The canonical SMILES for dodecan-3-ylsulfanyl 2-methylpropanoate is CCCCCCCCCC(CC)SOC(=O)C(C)C.
What is the InChIKey of dodecan-3-ylsulfanyl 2-methylpropanoate?
The InChIKey is LUCQVIZVKPGLLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2S/c1-5-7-8-9-10-11-12-13-15(6-2)19-18-16(17)14(3)4/h14-15H,5-13H2,1-4H3.
What are the key properties of dodecan-3-ylsulfanyl 2-methylpropanoate?
dodecan-3-ylsulfanyl 2-methylpropanoate has a molecular weight of 288.50 g/mol, XLogP of 5.75, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dodecan-3-ylsulfanyl 2-methylpropanoate is sourced from PubChem (CID 90032469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).