About 1-oxido-1,2-dihydropyridin-1-ium-3-carboxamide
1-oxido-1,2-dihydropyridin-1-ium-3-carboxamide (PubChem CID 90032858) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is 1-oxido-1,2-dihydropyridin-1-ium-3-carboxamide.
Molecular Properties
| Compound Name | 1-oxido-1,2-dihydropyridin-1-ium-3-carboxamide |
| PubChem CID | 90032858 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 1-oxido-1,2-dihydropyridin-1-ium-3-carboxamide |
| SMILES | NC(=O)C1=CC=C[NH+]([O-])C1 |
| InChI | InChI=1S/C6H8N2O2/c7-6(9)5-2-1-3-8(10)4-5/h1-3,8H,4H2,(H2,7,9) |
| InChIKey | KAOSVQOKZCODBJ-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-oxido-1,2-dihydropyridin-1-ium-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxido-1,2-dihydropyridin-1-ium-3-carboxamide?
The IUPAC name of 1-oxido-1,2-dihydropyridin-1-ium-3-carboxamide (CID 90032858) is 1-oxido-1,2-dihydropyridin-1-ium-3-carboxamide.
What is the SMILES notation for 1-oxido-1,2-dihydropyridin-1-ium-3-carboxamide?
The canonical SMILES for 1-oxido-1,2-dihydropyridin-1-ium-3-carboxamide is NC(=O)C1=CC=C[NH+]([O-])C1.
What is the InChIKey of 1-oxido-1,2-dihydropyridin-1-ium-3-carboxamide?
The InChIKey is KAOSVQOKZCODBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c7-6(9)5-2-1-3-8(10)4-5/h1-3,8H,4H2,(H2,7,9).
What are the key properties of 1-oxido-1,2-dihydropyridin-1-ium-3-carboxamide?
1-oxido-1,2-dihydropyridin-1-ium-3-carboxamide has a molecular weight of 140.14 g/mol, XLogP of -1.69, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxido-1,2-dihydropyridin-1-ium-3-carboxamide is sourced from PubChem (CID 90032858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).