C43H39F5N2O6S — CID 90032889
benzyl 5-[[3-(4-cyclohexylphenyl)-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-2-phenylmethoxybenzoate (PubChem CID 90032889) has the molecular formula C43H39F5N2O6S and a molecular weight of 806.85 g/mol. Its IUPAC name is benzyl 5-[[3-(4-cyclohexylphenyl)-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-2-phenylmethoxybenzoate.
| Compound Name | benzyl 5-[[3-(4-cyclohexylphenyl)-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-2-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 90032889 |
| Molecular Formula | C43H39F5N2O6S |
| Molecular Weight | 806.85 g/mol |
| Exact Mass | 806.24 |
| IUPAC Name | benzyl 5-[[3-(4-cyclohexylphenyl)-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-2-phenylmethoxybenzoate |
| SMILES | CN(C(Cc1ccc(C2CCCCC2)cc1)C(=O)Nc1ccc(OCc2ccccc2)c(C(=O)OCc2ccccc2)c1)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C43H39F5N2O6S/c1-50(57(53,54)41-39(47)37(45)36(44)38(46)40(41)48)34(23-27-17-19-31(20-18-27)30-15-9-4-10-16-30)42(51)49-32-21-22-35(55-25-28-11-5-2-6-12-28)33(24-32)43(52)56-26-29-13-7-3-8-14-29/h2-3,5-8,11-14,17-22,24,30,34H,4,9-10,15-16,23,25-26H2,1H3,(H,49,51) |
| InChIKey | NHGKLEICGGPRQP-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.85 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|