About 6-ethenyl-4-methyl-N,N-bis(prop-2-enyl)undec-1-en-5-amine
6-ethenyl-4-methyl-N,N-bis(prop-2-enyl)undec-1-en-5-amine (PubChem CID 90033165) has the molecular formula C20H35N
and a molecular weight of 289.51 g/mol. Its IUPAC name is 6-ethenyl-4-methyl-N,N-bis(prop-2-enyl)undec-1-en-5-amine.
Molecular Properties
| Compound Name | 6-ethenyl-4-methyl-N,N-bis(prop-2-enyl)undec-1-en-5-amine |
| PubChem CID | 90033165 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | 6-ethenyl-4-methyl-N,N-bis(prop-2-enyl)undec-1-en-5-amine |
| SMILES | C=CCC(C)C(C(C=C)CCCCC)N(CC=C)CC=C |
| InChI | InChI=1S/C20H35N/c1-7-12-13-15-19(11-5)20(18(6)14-8-2)21(16-9-3)17-10-4/h8-11,18-20H,2-5,7,12-17H2,1,6H3 |
| InChIKey | OFKPAXJQYAJVSS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-ethenyl-4-methyl-N,N-bis(prop-2-enyl)undec-1-en-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-4-methyl-N,N-bis(prop-2-enyl)undec-1-en-5-amine?
The IUPAC name of 6-ethenyl-4-methyl-N,N-bis(prop-2-enyl)undec-1-en-5-amine (CID 90033165) is 6-ethenyl-4-methyl-N,N-bis(prop-2-enyl)undec-1-en-5-amine.
What is the SMILES notation for 6-ethenyl-4-methyl-N,N-bis(prop-2-enyl)undec-1-en-5-amine?
The canonical SMILES for 6-ethenyl-4-methyl-N,N-bis(prop-2-enyl)undec-1-en-5-amine is C=CCC(C)C(C(C=C)CCCCC)N(CC=C)CC=C.
What is the InChIKey of 6-ethenyl-4-methyl-N,N-bis(prop-2-enyl)undec-1-en-5-amine?
The InChIKey is OFKPAXJQYAJVSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35N/c1-7-12-13-15-19(11-5)20(18(6)14-8-2)21(16-9-3)17-10-4/h8-11,18-20H,2-5,7,12-17H2,1,6H3.
What are the key properties of 6-ethenyl-4-methyl-N,N-bis(prop-2-enyl)undec-1-en-5-amine?
6-ethenyl-4-methyl-N,N-bis(prop-2-enyl)undec-1-en-5-amine has a molecular weight of 289.51 g/mol, XLogP of 5.62, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-4-methyl-N,N-bis(prop-2-enyl)undec-1-en-5-amine is sourced from PubChem (CID 90033165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).