About ethyl 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole-2-carboxylate
ethyl 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole-2-carboxylate (PubChem CID 90033688) has the molecular formula C27H39NO3
and a molecular weight of 425.61 g/mol. Its IUPAC name is ethyl 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole-2-carboxylate |
| PubChem CID | 90033688 |
| Molecular Formula | C27H39NO3 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | ethyl 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c(CC2CCCCC2)o1 |
| InChI | InChI=1S/C27H39NO3/c1-8-30-25(29)24-28-23(22(31-24)14-18-12-10-9-11-13-18)19-15-20(26(2,3)4)17-21(16-19)27(5,6)7/h15-18H,8-14H2,1-7H3 |
| InChIKey | PRNSIXGOQKPRPS-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole-2-carboxylate?
The IUPAC name of ethyl 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole-2-carboxylate (CID 90033688) is ethyl 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole-2-carboxylate.
What is the SMILES notation for ethyl 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole-2-carboxylate?
The canonical SMILES for ethyl 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole-2-carboxylate is CCOC(=O)c1nc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c(CC2CCCCC2)o1.
What is the InChIKey of ethyl 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole-2-carboxylate?
The InChIKey is PRNSIXGOQKPRPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H39NO3/c1-8-30-25(29)24-28-23(22(31-24)14-18-12-10-9-11-13-18)19-15-20(26(2,3)4)17-21(16-19)27(5,6)7/h15-18H,8-14H2,1-7H3.
What are the key properties of ethyl 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole-2-carboxylate?
ethyl 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole-2-carboxylate has a molecular weight of 425.61 g/mol, XLogP of 7.24, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole-2-carboxylate is sourced from PubChem (CID 90033688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).