C19H22F2N6OS — CID 90033796
(4aR,7aS)-6-(5-fluoro-4-methoxy-6-methylpyrimidin-2-yl)-7a-[2-fluoro-5-(methylamino)phenyl]-4,4a,5,7-tetrahydropyrrolo[3,4-e][1,3]thiazin-2-amine (PubChem CID 90033796) has the molecular formula C19H22F2N6OS and a molecular weight of 420.49 g/mol. Its IUPAC name is (4aR,7aS)-6-(5-fluoro-4-methoxy-6-methylpyrimidin-2-yl)-7a-[2-fluoro-5-(methylamino)phenyl]-4,4a,5,7-tetrahydropyrrolo[3,4-e][1,3]thiazin-2-amine.
| Compound Name | (4aR,7aS)-6-(5-fluoro-4-methoxy-6-methylpyrimidin-2-yl)-7a-[2-fluoro-5-(methylamino)phenyl]-4,4a,5,7-tetrahydropyrrolo[3,4-e][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 90033796 |
| Molecular Formula | C19H22F2N6OS |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (4aR,7aS)-6-(5-fluoro-4-methoxy-6-methylpyrimidin-2-yl)-7a-[2-fluoro-5-(methylamino)phenyl]-4,4a,5,7-tetrahydropyrrolo[3,4-e][1,3]thiazin-2-amine |
| SMILES | CNc1ccc(F)c([C@]23CN(c4nc(C)c(F)c(OC)n4)C[C@@H]2CN=C(N)S3)c1 |
| InChI | InChI=1S/C19H22F2N6OS/c1-10-15(21)16(28-3)26-18(25-10)27-8-11-7-24-17(22)29-19(11,9-27)13-6-12(23-2)4-5-14(13)20/h4-6,11,23H,7-9H2,1-3H3,(H2,22,24)/t11-,19-/m0/s1 |
| InChIKey | ROKGYOXSUYVOKH-WLRWDXFRSA-N |
| XLogP | 2.51 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |