C26H28BF2IN4O2 — CID 90033921
1-[(2-fluorophenyl)methyl]-4-iodopyrazole;1-[(2-fluorophenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 90033921) has the molecular formula C26H28BF2IN4O2 and a molecular weight of 604.25 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-4-iodopyrazole;1-[(2-fluorophenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-[(2-fluorophenyl)methyl]-4-iodopyrazole;1-[(2-fluorophenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 90033921 |
| Molecular Formula | C26H28BF2IN4O2 |
| Molecular Weight | 604.25 g/mol |
| Exact Mass | 604.13 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-4-iodopyrazole;1-[(2-fluorophenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | CC1(C)OB(c2cnn(Cc3ccccc3F)c2)OC1(C)C.Fc1ccccc1Cn1cc(I)cn1 |
| InChI | InChI=1S/C16H20BFN2O2.C10H8FIN2/c1-15(2)16(3,4)22-17(21-15)13-9-19-20(11-13)10-12-7-5-6-8-14(12)18;11-10-4-2-1-3-8(10)6-14-7-9(12)5-13-14/h5-9,11H,10H2,1-4H3;1-5,7H,6H2 |
| InChIKey | MGDFIRXAXYOEPQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.25 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|