C32H28F4N6O5S — CID 90034243
4-[[6-[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-N-(2-methylsulfonylethyl)-3-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 90034243) has the molecular formula C32H28F4N6O5S and a molecular weight of 684.67 g/mol. Its IUPAC name is 4-[[6-[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-N-(2-methylsulfonylethyl)-3-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | 4-[[6-[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-N-(2-methylsulfonylethyl)-3-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 90034243 |
| Molecular Formula | C32H28F4N6O5S |
| Molecular Weight | 684.67 g/mol |
| Exact Mass | 684.18 |
| IUPAC Name | 4-[[6-[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-N-(2-methylsulfonylethyl)-3-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | CS(=O)(=O)CCNC(=O)c1ccc(Nc2nc3ccc(-c4ccc(NC(=O)Cc5ccc(F)cc5)cc4)cn3n2)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C32H28F4N6O5S/c1-48(45,46)15-14-37-30(44)22-6-12-26(27(17-22)47-19-32(34,35)36)39-31-40-28-13-7-23(18-42(28)41-31)21-4-10-25(11-5-21)38-29(43)16-20-2-8-24(33)9-3-20/h2-13,17-18H,14-16,19H2,1H3,(H,37,44)(H,38,43)(H,39,41) |
| InChIKey | LLKAPLHVCMNZIH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 143.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |