About 6-bromo-3,3-diethyl-7-methoxy-1,2-dihydroindole
6-bromo-3,3-diethyl-7-methoxy-1,2-dihydroindole (PubChem CID 90034768) has the molecular formula C13H18BrNO
and a molecular weight of 284.20 g/mol. Its IUPAC name is 6-bromo-3,3-diethyl-7-methoxy-1,2-dihydroindole.
Molecular Properties
| Compound Name | 6-bromo-3,3-diethyl-7-methoxy-1,2-dihydroindole |
| PubChem CID | 90034768 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 6-bromo-3,3-diethyl-7-methoxy-1,2-dihydroindole |
| SMILES | CCC1(CC)CNc2c1ccc(Br)c2OC |
| InChI | InChI=1S/C13H18BrNO/c1-4-13(5-2)8-15-11-9(13)6-7-10(14)12(11)16-3/h6-7,15H,4-5,8H2,1-3H3 |
| InChIKey | IOXNJGVTYPUQTA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-3,3-diethyl-7-methoxy-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3,3-diethyl-7-methoxy-1,2-dihydroindole?
The IUPAC name of 6-bromo-3,3-diethyl-7-methoxy-1,2-dihydroindole (CID 90034768) is 6-bromo-3,3-diethyl-7-methoxy-1,2-dihydroindole.
What is the SMILES notation for 6-bromo-3,3-diethyl-7-methoxy-1,2-dihydroindole?
The canonical SMILES for 6-bromo-3,3-diethyl-7-methoxy-1,2-dihydroindole is CCC1(CC)CNc2c1ccc(Br)c2OC.
What is the InChIKey of 6-bromo-3,3-diethyl-7-methoxy-1,2-dihydroindole?
The InChIKey is IOXNJGVTYPUQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BrNO/c1-4-13(5-2)8-15-11-9(13)6-7-10(14)12(11)16-3/h6-7,15H,4-5,8H2,1-3H3.
What are the key properties of 6-bromo-3,3-diethyl-7-methoxy-1,2-dihydroindole?
6-bromo-3,3-diethyl-7-methoxy-1,2-dihydroindole has a molecular weight of 284.20 g/mol, XLogP of 3.94, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3,3-diethyl-7-methoxy-1,2-dihydroindole is sourced from PubChem (CID 90034768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).