About (4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl) N-methyl-N-(4-methylpentan-2-yl)carbamoperoxoate
(4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl) N-methyl-N-(4-methylpentan-2-yl)carbamoperoxoate (PubChem CID 90034951) has the molecular formula C22H27N3O4
and a molecular weight of 397.48 g/mol. Its IUPAC name is (4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl) N-methyl-N-(4-methylpentan-2-yl)carbamoperoxoate.
Molecular Properties
| Compound Name | (4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl) N-methyl-N-(4-methylpentan-2-yl)carbamoperoxoate |
| PubChem CID | 90034951 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl) N-methyl-N-(4-methylpentan-2-yl)carbamoperoxoate |
| SMILES | Cc1nccc2c1c(=O)n(C)c1cc(OOC(=O)N(C)C(C)CC(C)C)ccc21 |
| InChI | InChI=1S/C22H27N3O4/c1-13(2)11-14(3)24(5)22(27)29-28-16-7-8-17-18-9-10-23-15(4)20(18)21(26)25(6)19(17)12-16/h7-10,12-14H,11H2,1-6H3 |
| InChIKey | CLYRGAIKIXAJSD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl) N-methyl-N-(4-methylpentan-2-yl)carbamoperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl) N-methyl-N-(4-methylpentan-2-yl)carbamoperoxoate?
The IUPAC name of (4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl) N-methyl-N-(4-methylpentan-2-yl)carbamoperoxoate (CID 90034951) is (4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl) N-methyl-N-(4-methylpentan-2-yl)carbamoperoxoate.
What is the SMILES notation for (4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl) N-methyl-N-(4-methylpentan-2-yl)carbamoperoxoate?
The canonical SMILES for (4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl) N-methyl-N-(4-methylpentan-2-yl)carbamoperoxoate is Cc1nccc2c1c(=O)n(C)c1cc(OOC(=O)N(C)C(C)CC(C)C)ccc21.
What is the InChIKey of (4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl) N-methyl-N-(4-methylpentan-2-yl)carbamoperoxoate?
The InChIKey is CLYRGAIKIXAJSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O4/c1-13(2)11-14(3)24(5)22(27)29-28-16-7-8-17-18-9-10-23-15(4)20(18)21(26)25(6)19(17)12-16/h7-10,12-14H,11H2,1-6H3.
What are the key properties of (4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl) N-methyl-N-(4-methylpentan-2-yl)carbamoperoxoate?
(4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl) N-methyl-N-(4-methylpentan-2-yl)carbamoperoxoate has a molecular weight of 397.48 g/mol, XLogP of 4.19, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl) N-methyl-N-(4-methylpentan-2-yl)carbamoperoxoate is sourced from PubChem (CID 90034951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).