About 2-[4-chloro-7-methoxy-1'-(2-methylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]aniline
2-[4-chloro-7-methoxy-1'-(2-methylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]aniline (PubChem CID 90035015) has the molecular formula C23H30ClN3O
and a molecular weight of 399.97 g/mol. Its IUPAC name is 2-[4-chloro-7-methoxy-1'-(2-methylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]aniline.
Molecular Properties
| Compound Name | 2-[4-chloro-7-methoxy-1'-(2-methylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]aniline |
| PubChem CID | 90035015 |
| Molecular Formula | C23H30ClN3O |
| Molecular Weight | 399.97 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-[4-chloro-7-methoxy-1'-(2-methylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]aniline |
| SMILES | COc1ccc(Cl)c2c1N(c1ccccc1N)CC21CCN(CC(C)C)CC1 |
| InChI | InChI=1S/C23H30ClN3O/c1-16(2)14-26-12-10-23(11-13-26)15-27(19-7-5-4-6-18(19)25)22-20(28-3)9-8-17(24)21(22)23/h4-9,16H,10-15,25H2,1-3H3 |
| InChIKey | PQKMIFXTNVCXIS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.97 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-chloro-7-methoxy-1'-(2-methylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-chloro-7-methoxy-1'-(2-methylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]aniline?
The IUPAC name of 2-[4-chloro-7-methoxy-1'-(2-methylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]aniline (CID 90035015) is 2-[4-chloro-7-methoxy-1'-(2-methylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]aniline.
What is the SMILES notation for 2-[4-chloro-7-methoxy-1'-(2-methylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]aniline?
The canonical SMILES for 2-[4-chloro-7-methoxy-1'-(2-methylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]aniline is COc1ccc(Cl)c2c1N(c1ccccc1N)CC21CCN(CC(C)C)CC1.
What is the InChIKey of 2-[4-chloro-7-methoxy-1'-(2-methylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]aniline?
The InChIKey is PQKMIFXTNVCXIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30ClN3O/c1-16(2)14-26-12-10-23(11-13-26)15-27(19-7-5-4-6-18(19)25)22-20(28-3)9-8-17(24)21(22)23/h4-9,16H,10-15,25H2,1-3H3.
What are the key properties of 2-[4-chloro-7-methoxy-1'-(2-methylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]aniline?
2-[4-chloro-7-methoxy-1'-(2-methylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]aniline has a molecular weight of 399.97 g/mol, XLogP of 5.07, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-chloro-7-methoxy-1'-(2-methylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]aniline is sourced from PubChem (CID 90035015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).