C21H22FN7O — CID 90035100
7-[(2R)-4-azido-2-methylbutyl]-2-(3-fluoro-2-methylquinoxalin-5-yl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 90035100) has the molecular formula C21H22FN7O and a molecular weight of 407.45 g/mol. Its IUPAC name is 7-[(2R)-4-azido-2-methylbutyl]-2-(3-fluoro-2-methylquinoxalin-5-yl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 7-[(2R)-4-azido-2-methylbutyl]-2-(3-fluoro-2-methylquinoxalin-5-yl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 90035100 |
| Molecular Formula | C21H22FN7O |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 7-[(2R)-4-azido-2-methylbutyl]-2-(3-fluoro-2-methylquinoxalin-5-yl)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | Cc1nc2cccc(-c3cc4c([nH]3)C(C[C@@H](C)CCN=[N+]=[N-])CNC4=O)c2nc1F |
| InChI | InChI=1S/C21H22FN7O/c1-11(6-7-25-29-23)8-13-10-24-21(30)15-9-17(27-18(13)15)14-4-3-5-16-19(14)28-20(22)12(2)26-16/h3-5,9,11,13,27H,6-8,10H2,1-2H3,(H,24,30)/t11-,13?/m0/s1 |
| InChIKey | SUDUAAVFQFZRDI-AMGKYWFPSA-N |
| XLogP | 4.63 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|