C19H13ClFN3O — CID 90035836
6-(4-chloro-3-fluorophenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile (PubChem CID 90035836) has the molecular formula C19H13ClFN3O and a molecular weight of 353.78 g/mol. Its IUPAC name is 6-(4-chloro-3-fluorophenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile.
| Compound Name | 6-(4-chloro-3-fluorophenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile |
|---|---|
| PubChem CID | 90035836 |
| Molecular Formula | C19H13ClFN3O |
| Molecular Weight | 353.78 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 6-(4-chloro-3-fluorophenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile |
| SMILES | Cc1c2n(c3c(-c4ccc(Cl)c(F)c4)cc(C#N)cc13)CCNC2=O |
| InChI | InChI=1S/C19H13ClFN3O/c1-10-13-6-11(9-22)7-14(12-2-3-15(20)16(21)8-12)18(13)24-5-4-23-19(25)17(10)24/h2-3,6-8H,4-5H2,1H3,(H,23,25) |
| InChIKey | UEEQRAIWXXLSLV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.78 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|