C18H10F3N3O — CID 90035947
1-oxo-6-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile (PubChem CID 90035947) has the molecular formula C18H10F3N3O and a molecular weight of 341.29 g/mol. Its IUPAC name is 1-oxo-6-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile.
| Compound Name | 1-oxo-6-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile |
|---|---|
| PubChem CID | 90035947 |
| Molecular Formula | C18H10F3N3O |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 1-oxo-6-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile |
| SMILES | N#Cc1cc(-c2cc(F)c(F)c(F)c2)c2c(c1)cc1n2CCNC1=O |
| InChI | InChI=1S/C18H10F3N3O/c19-13-5-10(6-14(20)16(13)21)12-4-9(8-22)3-11-7-15-18(25)23-1-2-24(15)17(11)12/h3-7H,1-2H2,(H,23,25) |
| InChIKey | OLHKQOTVNIMLPV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|