C15H16Cl2N2O4S — CID 9003602
[2-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate (PubChem CID 9003602) has the molecular formula C15H16Cl2N2O4S and a molecular weight of 391.28 g/mol. Its IUPAC name is [2-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate.
| Compound Name | [2-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
|---|---|
| PubChem CID | 9003602 |
| Molecular Formula | C15H16Cl2N2O4S |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | [2-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
| SMILES | C[C@@H](NC(=O)COC(=O)CN1CCSC1=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H16Cl2N2O4S/c1-9(11-3-2-10(16)6-12(11)17)18-13(20)8-23-14(21)7-19-4-5-24-15(19)22/h2-3,6,9H,4-5,7-8H2,1H3,(H,18,20)/t9-/m1/s1 |
| InChIKey | YZZGAAOYVMGPPY-SECBINFHSA-N |
| XLogP | 2.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|