C19H14N4O3 — CID 90036111
7-(4-nitrophenyl)-1-oxo-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-9-carbonitrile (PubChem CID 90036111) has the molecular formula C19H14N4O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is 7-(4-nitrophenyl)-1-oxo-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-9-carbonitrile.
| Compound Name | 7-(4-nitrophenyl)-1-oxo-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-9-carbonitrile |
|---|---|
| PubChem CID | 90036111 |
| Molecular Formula | C19H14N4O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 7-(4-nitrophenyl)-1-oxo-2,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]indole-9-carbonitrile |
| SMILES | N#Cc1cc(-c2ccc([N+](=O)[O-])cc2)c2c(c1)cc1n2CCCNC1=O |
| InChI | InChI=1S/C19H14N4O3/c20-11-12-8-14-10-17-19(24)21-6-1-7-22(17)18(14)16(9-12)13-2-4-15(5-3-13)23(25)26/h2-5,8-10H,1,6-7H2,(H,21,24) |
| InChIKey | SMKJKSVVHCSURO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|