C25H34ClN5OS — CID 90036207
1-amino-1-[2-[4-chloro-7-(1-methoxy-2,2-dimethylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]phenyl]thiourea (PubChem CID 90036207) has the molecular formula C25H34ClN5OS and a molecular weight of 488.10 g/mol. Its IUPAC name is 1-amino-1-[2-[4-chloro-7-(1-methoxy-2,2-dimethylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]phenyl]thiourea.
| Compound Name | 1-amino-1-[2-[4-chloro-7-(1-methoxy-2,2-dimethylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 90036207 |
| Molecular Formula | C25H34ClN5OS |
| Molecular Weight | 488.10 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 1-amino-1-[2-[4-chloro-7-(1-methoxy-2,2-dimethylpropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]phenyl]thiourea |
| SMILES | COC(c1ccc(Cl)c2c1N(c1ccccc1N(N)C(N)=S)CC21CCNCC1)C(C)(C)C |
| InChI | InChI=1S/C25H34ClN5OS/c1-24(2,3)22(32-4)16-9-10-17(26)20-21(16)30(15-25(20)11-13-29-14-12-25)18-7-5-6-8-19(18)31(28)23(27)33/h5-10,22,29H,11-15,28H2,1-4H3,(H2,27,33) |
| InChIKey | QZTURUBRHXEYBY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.10 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|