About 6-(4-methoxyphenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile
6-(4-methoxyphenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile (PubChem CID 90036215) has the molecular formula C20H17N3O2
and a molecular weight of 331.38 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile.
Molecular Properties
| Compound Name | 6-(4-methoxyphenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile |
| PubChem CID | 90036215 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 6-(4-methoxyphenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile |
| SMILES | COc1ccc(-c2cc(C#N)cc3c(C)c4n(c23)CCNC4=O)cc1 |
| InChI | InChI=1S/C20H17N3O2/c1-12-16-9-13(11-21)10-17(14-3-5-15(25-2)6-4-14)19(16)23-8-7-22-20(24)18(12)23/h3-6,9-10H,7-8H2,1-2H3,(H,22,24) |
| InChIKey | DRICTVIAMIAFFG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-methoxyphenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methoxyphenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile?
The IUPAC name of 6-(4-methoxyphenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile (CID 90036215) is 6-(4-methoxyphenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile.
What is the SMILES notation for 6-(4-methoxyphenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile?
The canonical SMILES for 6-(4-methoxyphenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile is COc1ccc(-c2cc(C#N)cc3c(C)c4n(c23)CCNC4=O)cc1.
What is the InChIKey of 6-(4-methoxyphenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile?
The InChIKey is DRICTVIAMIAFFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O2/c1-12-16-9-13(11-21)10-17(14-3-5-15(25-2)6-4-14)19(16)23-8-7-22-20(24)18(12)23/h3-6,9-10H,7-8H2,1-2H3,(H,22,24).
What are the key properties of 6-(4-methoxyphenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile?
6-(4-methoxyphenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile has a molecular weight of 331.38 g/mol, XLogP of 3.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methoxyphenyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile is sourced from PubChem (CID 90036215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).