C19H17FN2O3S — CID 90036266
8-fluoro-10-methyl-6-(4-methylsulfonylphenyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one (PubChem CID 90036266) has the molecular formula C19H17FN2O3S and a molecular weight of 372.42 g/mol. Its IUPAC name is 8-fluoro-10-methyl-6-(4-methylsulfonylphenyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one.
| Compound Name | 8-fluoro-10-methyl-6-(4-methylsulfonylphenyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 90036266 |
| Molecular Formula | C19H17FN2O3S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 8-fluoro-10-methyl-6-(4-methylsulfonylphenyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one |
| SMILES | Cc1c2n(c3c(-c4ccc(S(C)(=O)=O)cc4)cc(F)cc13)CCNC2=O |
| InChI | InChI=1S/C19H17FN2O3S/c1-11-15-9-13(20)10-16(12-3-5-14(6-4-12)26(2,24)25)18(15)22-8-7-21-19(23)17(11)22/h3-6,9-10H,7-8H2,1-2H3,(H,21,23) |
| InChIKey | SXZPWJLSMHNCFQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|