C24H25BrN10O6 — CID 90036357
6-bromo-4-(phenylmethoxymethyl)-2-(2-pyrazol-1-ylethyl)-1,2,4-triazine-3,5-dione;2-(2-pyrazol-1-ylethyl)-1,2,4-triazinane-3,5,6-trione (PubChem CID 90036357) has the molecular formula C24H25BrN10O6 and a molecular weight of 629.43 g/mol. Its IUPAC name is 6-bromo-4-(phenylmethoxymethyl)-2-(2-pyrazol-1-ylethyl)-1,2,4-triazine-3,5-dione;2-(2-pyrazol-1-ylethyl)-1,2,4-triazinane-3,5,6-trione.
| Compound Name | 6-bromo-4-(phenylmethoxymethyl)-2-(2-pyrazol-1-ylethyl)-1,2,4-triazine-3,5-dione;2-(2-pyrazol-1-ylethyl)-1,2,4-triazinane-3,5,6-trione |
|---|---|
| PubChem CID | 90036357 |
| Molecular Formula | C24H25BrN10O6 |
| Molecular Weight | 629.43 g/mol |
| Exact Mass | 628.11 |
| IUPAC Name | 6-bromo-4-(phenylmethoxymethyl)-2-(2-pyrazol-1-ylethyl)-1,2,4-triazine-3,5-dione;2-(2-pyrazol-1-ylethyl)-1,2,4-triazinane-3,5,6-trione |
| SMILES | O=c1[nH]c(=O)n(CCn2cccn2)[nH]c1=O.O=c1c(Br)nn(CCn2cccn2)c(=O)n1COCc1ccccc1 |
| InChI | InChI=1S/C16H16BrN5O3.C8H9N5O3/c17-14-15(23)21(12-25-11-13-5-2-1-3-6-13)16(24)22(19-14)10-9-20-8-4-7-18-20;14-6-7(15)11-13(8(16)10-6)5-4-12-3-1-2-9-12/h1-8H,9-12H2;1-3H,4-5H2,(H,11,15)(H,10,14,16) |
| InChIKey | AXJBHGWNHWJIKK-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 189.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.43 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|