About 4-methyl-6-phenyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one
4-methyl-6-phenyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one (PubChem CID 90036499) has the molecular formula C18H16N2O
and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-methyl-6-phenyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one.
Molecular Properties
| Compound Name | 4-methyl-6-phenyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one |
| PubChem CID | 90036499 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-methyl-6-phenyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one |
| SMILES | CC1CNC(=O)c2cc3cccc(-c4ccccc4)c3n21 |
| InChI | InChI=1S/C18H16N2O/c1-12-11-19-18(21)16-10-14-8-5-9-15(17(14)20(12)16)13-6-3-2-4-7-13/h2-10,12H,11H2,1H3,(H,19,21) |
| InChIKey | MWTLIQSOQFYRRW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-6-phenyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6-phenyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
The IUPAC name of 4-methyl-6-phenyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one (CID 90036499) is 4-methyl-6-phenyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one.
What is the SMILES notation for 4-methyl-6-phenyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
The canonical SMILES for 4-methyl-6-phenyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one is CC1CNC(=O)c2cc3cccc(-c4ccccc4)c3n21.
What is the InChIKey of 4-methyl-6-phenyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
The InChIKey is MWTLIQSOQFYRRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O/c1-12-11-19-18(21)16-10-14-8-5-9-15(17(14)20(12)16)13-6-3-2-4-7-13/h2-10,12H,11H2,1H3,(H,19,21).
What are the key properties of 4-methyl-6-phenyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
4-methyl-6-phenyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one has a molecular weight of 276.34 g/mol, XLogP of 3.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6-phenyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one is sourced from PubChem (CID 90036499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).