C16H11BrFN3O3 — CID 90036500
6-bromo-2-[[4-(2-fluorophenoxy)phenyl]methyl]-1,2,4-triazine-3,5-dione (PubChem CID 90036500) has the molecular formula C16H11BrFN3O3 and a molecular weight of 392.18 g/mol. Its IUPAC name is 6-bromo-2-[[4-(2-fluorophenoxy)phenyl]methyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 6-bromo-2-[[4-(2-fluorophenoxy)phenyl]methyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 90036500 |
| Molecular Formula | C16H11BrFN3O3 |
| Molecular Weight | 392.18 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 6-bromo-2-[[4-(2-fluorophenoxy)phenyl]methyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccc(Oc3ccccc3F)cc2)nc1Br |
| InChI | InChI=1S/C16H11BrFN3O3/c17-14-15(22)19-16(23)21(20-14)9-10-5-7-11(8-6-10)24-13-4-2-1-3-12(13)18/h1-8H,9H2,(H,19,22,23) |
| InChIKey | CFGCQEIDQWZARM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.18 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |