C18H16FN3O3 — CID 90036525
2-[2-(3-fluorophenyl)ethyl]-6-phenylmethoxy-1,2,4-triazine-3,5-dione (PubChem CID 90036525) has the molecular formula C18H16FN3O3 and a molecular weight of 341.34 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)ethyl]-6-phenylmethoxy-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[2-(3-fluorophenyl)ethyl]-6-phenylmethoxy-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 90036525 |
| Molecular Formula | C18H16FN3O3 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-[2-(3-fluorophenyl)ethyl]-6-phenylmethoxy-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]c(=O)n(CCc2cccc(F)c2)nc1OCc1ccccc1 |
| InChI | InChI=1S/C18H16FN3O3/c19-15-8-4-7-13(11-15)9-10-22-18(24)20-16(23)17(21-22)25-12-14-5-2-1-3-6-14/h1-8,11H,9-10,12H2,(H,20,23,24) |
| InChIKey | LBRLEIXTMPVXKG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |