C26H20F5N3O4 — CID 90036571
2-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]-6-phenylmethoxy-4-(phenylmethoxymethyl)-1,2,4-triazine-3,5-dione (PubChem CID 90036571) has the molecular formula C26H20F5N3O4 and a molecular weight of 533.45 g/mol. Its IUPAC name is 2-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]-6-phenylmethoxy-4-(phenylmethoxymethyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]-6-phenylmethoxy-4-(phenylmethoxymethyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 90036571 |
| Molecular Formula | C26H20F5N3O4 |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | 2-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]-6-phenylmethoxy-4-(phenylmethoxymethyl)-1,2,4-triazine-3,5-dione |
| SMILES | O=c1c(OCc2ccccc2)nn(CCc2c(F)c(F)c(F)c(F)c2F)c(=O)n1COCc1ccccc1 |
| InChI | InChI=1S/C26H20F5N3O4/c27-19-18(20(28)22(30)23(31)21(19)29)11-12-34-26(36)33(15-37-13-16-7-3-1-4-8-16)25(35)24(32-34)38-14-17-9-5-2-6-10-17/h1-10H,11-15H2 |
| InChIKey | RRWXVDBMQACFDW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|