C6H7N3O3 — CID 90036594
N-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)acetamide (PubChem CID 90036594) has the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. Its IUPAC name is N-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)acetamide.
| Compound Name | N-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 90036594 |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | N-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)acetamide |
| SMILES | CC(=O)Nc1c(O)nc[nH]c1=O |
| InChI | InChI=1S/C6H7N3O3/c1-3(10)9-4-5(11)7-2-8-6(4)12/h2H,1H3,(H,9,10)(H2,7,8,11,12) |
| InChIKey | WCHGYAIIRMOCRM-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |