About N-nonyl-N-(1,3-oxazol-2-yl)-2-phenylpropanamide
N-nonyl-N-(1,3-oxazol-2-yl)-2-phenylpropanamide (PubChem CID 90036677) has the molecular formula C21H30N2O2
and a molecular weight of 342.48 g/mol. Its IUPAC name is N-nonyl-N-(1,3-oxazol-2-yl)-2-phenylpropanamide.
Molecular Properties
| Compound Name | N-nonyl-N-(1,3-oxazol-2-yl)-2-phenylpropanamide |
| PubChem CID | 90036677 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | N-nonyl-N-(1,3-oxazol-2-yl)-2-phenylpropanamide |
| SMILES | CCCCCCCCCN(C(=O)C(C)c1ccccc1)c1ncco1 |
| InChI | InChI=1S/C21H30N2O2/c1-3-4-5-6-7-8-12-16-23(21-22-15-17-25-21)20(24)18(2)19-13-10-9-11-14-19/h9-11,13-15,17-18H,3-8,12,16H2,1-2H3 |
| InChIKey | DZRFHGBQNOZTAW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-nonyl-N-(1,3-oxazol-2-yl)-2-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-nonyl-N-(1,3-oxazol-2-yl)-2-phenylpropanamide?
The IUPAC name of N-nonyl-N-(1,3-oxazol-2-yl)-2-phenylpropanamide (CID 90036677) is N-nonyl-N-(1,3-oxazol-2-yl)-2-phenylpropanamide.
What is the SMILES notation for N-nonyl-N-(1,3-oxazol-2-yl)-2-phenylpropanamide?
The canonical SMILES for N-nonyl-N-(1,3-oxazol-2-yl)-2-phenylpropanamide is CCCCCCCCCN(C(=O)C(C)c1ccccc1)c1ncco1.
What is the InChIKey of N-nonyl-N-(1,3-oxazol-2-yl)-2-phenylpropanamide?
The InChIKey is DZRFHGBQNOZTAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N2O2/c1-3-4-5-6-7-8-12-16-23(21-22-15-17-25-21)20(24)18(2)19-13-10-9-11-14-19/h9-11,13-15,17-18H,3-8,12,16H2,1-2H3.
What are the key properties of N-nonyl-N-(1,3-oxazol-2-yl)-2-phenylpropanamide?
N-nonyl-N-(1,3-oxazol-2-yl)-2-phenylpropanamide has a molecular weight of 342.48 g/mol, XLogP of 5.56, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-nonyl-N-(1,3-oxazol-2-yl)-2-phenylpropanamide is sourced from PubChem (CID 90036677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).