C15H24N2O3Si — CID 90037045
5-(2-trimethylsilylethoxymethyl)-4,5-diazatricyclo[6.1.1.02,6]deca-2(6),3-diene-3-carboxylic acid (PubChem CID 90037045) has the molecular formula C15H24N2O3Si and a molecular weight of 308.45 g/mol. Its IUPAC name is 5-(2-trimethylsilylethoxymethyl)-4,5-diazatricyclo[6.1.1.02,6]deca-2(6),3-diene-3-carboxylic acid.
| Compound Name | 5-(2-trimethylsilylethoxymethyl)-4,5-diazatricyclo[6.1.1.02,6]deca-2(6),3-diene-3-carboxylic acid |
|---|---|
| PubChem CID | 90037045 |
| Molecular Formula | C15H24N2O3Si |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 5-(2-trimethylsilylethoxymethyl)-4,5-diazatricyclo[6.1.1.02,6]deca-2(6),3-diene-3-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1nc(C(=O)O)c2c1CC1CC2C1 |
| InChI | InChI=1S/C15H24N2O3Si/c1-21(2,3)5-4-20-9-17-12-8-10-6-11(7-10)13(12)14(16-17)15(18)19/h10-11H,4-9H2,1-3H3,(H,18,19) |
| InChIKey | ZQWWYKKKPDZGGE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|