C19H30N4O3Si — CID 90037531
ethyl 6-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxylate (PubChem CID 90037531) has the molecular formula C19H30N4O3Si and a molecular weight of 390.56 g/mol. Its IUPAC name is ethyl 6-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxylate.
| Compound Name | ethyl 6-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 90037531 |
| Molecular Formula | C19H30N4O3Si |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | ethyl 6-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxylate |
| SMILES | CCOC(=O)c1n[nH]c2c1CCC(c1cnn(COCC[Si](C)(C)C)c1)C2 |
| InChI | InChI=1S/C19H30N4O3Si/c1-5-26-19(24)18-16-7-6-14(10-17(16)21-22-18)15-11-20-23(12-15)13-25-8-9-27(2,3)4/h11-12,14H,5-10,13H2,1-4H3,(H,21,22) |
| InChIKey | UBBLHNGCFUMFAJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|