C23H22ClN7 — CID 90037579
3-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-pyrimidin-5-ylquinoxalin-2-amine (PubChem CID 90037579) has the molecular formula C23H22ClN7 and a molecular weight of 431.93 g/mol. Its IUPAC name is 3-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-pyrimidin-5-ylquinoxalin-2-amine.
| Compound Name | 3-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-pyrimidin-5-ylquinoxalin-2-amine |
|---|---|
| PubChem CID | 90037579 |
| Molecular Formula | C23H22ClN7 |
| Molecular Weight | 431.93 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 3-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-pyrimidin-5-ylquinoxalin-2-amine |
| SMILES | Clc1cccc(CN2CCN(c3nc4ccccc4nc3Nc3cncnc3)CC2)c1 |
| InChI | InChI=1S/C23H22ClN7/c24-18-5-3-4-17(12-18)15-30-8-10-31(11-9-30)23-22(27-19-13-25-16-26-14-19)28-20-6-1-2-7-21(20)29-23/h1-7,12-14,16H,8-11,15H2,(H,27,28) |
| InChIKey | SUKVNZRMHZZMGP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.93 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |