C24H28N4O5 — CID 90038187
4-[7-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-[3-(methoxymethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-yl]morpholine (PubChem CID 90038187) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is 4-[7-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-[3-(methoxymethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[7-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-[3-(methoxymethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 90038187 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 4-[7-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-[3-(methoxymethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-yl]morpholine |
| SMILES | COCOc1cccc(-c2nc(N3CCOCC3)c3ncc(C4COC(C)(C)O4)cc3n2)c1 |
| InChI | InChI=1S/C24H28N4O5/c1-24(2)32-14-20(33-24)17-12-19-21(25-13-17)23(28-7-9-30-10-8-28)27-22(26-19)16-5-4-6-18(11-16)31-15-29-3/h4-6,11-13,20H,7-10,14-15H2,1-3H3 |
| InChIKey | ZMWBCMRMUYBMPA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 88.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|