About 2,3-dichloropyrazino[2,3-d]pyridazine;hydrochloride
2,3-dichloropyrazino[2,3-d]pyridazine;hydrochloride (PubChem CID 90038567) has the molecular formula C6H3Cl3N4
and a molecular weight of 237.48 g/mol. Its IUPAC name is 2,3-dichloropyrazino[2,3-d]pyridazine;hydrochloride.
Molecular Properties
| Compound Name | 2,3-dichloropyrazino[2,3-d]pyridazine;hydrochloride |
| PubChem CID | 90038567 |
| Molecular Formula | C6H3Cl3N4 |
| Molecular Weight | 237.48 g/mol |
| Exact Mass | 235.94 |
| IUPAC Name | 2,3-dichloropyrazino[2,3-d]pyridazine;hydrochloride |
| SMILES | Cl.Clc1nc2cnncc2nc1Cl |
| InChI | InChI=1S/C6H2Cl2N4.ClH/c7-5-6(8)12-4-2-10-9-1-3(4)11-5;/h1-2H;1H |
| InChIKey | YDEPSDKYNYZECH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dichloropyrazino[2,3-d]pyridazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloropyrazino[2,3-d]pyridazine;hydrochloride?
The IUPAC name of 2,3-dichloropyrazino[2,3-d]pyridazine;hydrochloride (CID 90038567) is 2,3-dichloropyrazino[2,3-d]pyridazine;hydrochloride.
What is the SMILES notation for 2,3-dichloropyrazino[2,3-d]pyridazine;hydrochloride?
The canonical SMILES for 2,3-dichloropyrazino[2,3-d]pyridazine;hydrochloride is Cl.Clc1nc2cnncc2nc1Cl.
What is the InChIKey of 2,3-dichloropyrazino[2,3-d]pyridazine;hydrochloride?
The InChIKey is YDEPSDKYNYZECH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Cl2N4.ClH/c7-5-6(8)12-4-2-10-9-1-3(4)11-5;/h1-2H;1H.
What are the key properties of 2,3-dichloropyrazino[2,3-d]pyridazine;hydrochloride?
2,3-dichloropyrazino[2,3-d]pyridazine;hydrochloride has a molecular weight of 237.48 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloropyrazino[2,3-d]pyridazine;hydrochloride is sourced from PubChem (CID 90038567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).