C24H29ClN2O6S — CID 90038568
2-[2-[[4-[(5-chloro-6-oxo-2-propan-2-yl-1,5-dihydropyridazin-4-yl)oxymethyl]phenyl]methoxy]ethyl]-3-methylbenzenesulfonic acid (PubChem CID 90038568) has the molecular formula C24H29ClN2O6S and a molecular weight of 509.02 g/mol. Its IUPAC name is 2-[2-[[4-[(5-chloro-6-oxo-2-propan-2-yl-1,5-dihydropyridazin-4-yl)oxymethyl]phenyl]methoxy]ethyl]-3-methylbenzenesulfonic acid.
| Compound Name | 2-[2-[[4-[(5-chloro-6-oxo-2-propan-2-yl-1,5-dihydropyridazin-4-yl)oxymethyl]phenyl]methoxy]ethyl]-3-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 90038568 |
| Molecular Formula | C24H29ClN2O6S |
| Molecular Weight | 509.02 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 2-[2-[[4-[(5-chloro-6-oxo-2-propan-2-yl-1,5-dihydropyridazin-4-yl)oxymethyl]phenyl]methoxy]ethyl]-3-methylbenzenesulfonic acid |
| SMILES | Cc1cccc(S(=O)(=O)O)c1CCOCc1ccc(COC2=CN(C(C)C)NC(=O)C2Cl)cc1 |
| InChI | InChI=1S/C24H29ClN2O6S/c1-16(2)27-13-21(23(25)24(28)26-27)33-15-19-9-7-18(8-10-19)14-32-12-11-20-17(3)5-4-6-22(20)34(29,30)31/h4-10,13,16,23H,11-12,14-15H2,1-3H3,(H,26,28)(H,29,30,31) |
| InChIKey | HMEBUOCWTJBUSG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.02 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|