C23H27Cl2N5O — CID 90038696
3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(2-ethoxyethyl)quinoxalin-2-amine (PubChem CID 90038696) has the molecular formula C23H27Cl2N5O and a molecular weight of 460.41 g/mol. Its IUPAC name is 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(2-ethoxyethyl)quinoxalin-2-amine.
| Compound Name | 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(2-ethoxyethyl)quinoxalin-2-amine |
|---|---|
| PubChem CID | 90038696 |
| Molecular Formula | C23H27Cl2N5O |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(2-ethoxyethyl)quinoxalin-2-amine |
| SMILES | CCOCCNc1nc2ccccc2nc1N1CCN(Cc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C23H27Cl2N5O/c1-2-31-14-9-26-22-23(28-21-6-4-3-5-20(21)27-22)30-12-10-29(11-13-30)16-17-15-18(24)7-8-19(17)25/h3-8,15H,2,9-14,16H2,1H3,(H,26,27) |
| InChIKey | ZLTWSXLZENBVJH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|