C19H16N4O3S — CID 9003883
(7R,11R)-7,11-diphenyl-9-sulfanylidene-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5-trione (PubChem CID 9003883) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is (7R,11R)-7,11-diphenyl-9-sulfanylidene-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5-trione.
| Compound Name | (7R,11R)-7,11-diphenyl-9-sulfanylidene-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5-trione |
|---|---|
| PubChem CID | 9003883 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (7R,11R)-7,11-diphenyl-9-sulfanylidene-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5-trione |
| SMILES | O=C1NC(=O)C2(C(=O)N1)[C@@H](c1ccccc1)NC(=S)N[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C19H16N4O3S/c24-15-19(16(25)23-17(26)22-15)13(11-7-3-1-4-8-11)20-18(27)21-14(19)12-9-5-2-6-10-12/h1-10,13-14H,(H2,20,21,27)(H2,22,23,24,25,26)/t13-,14-/m1/s1 |
| InChIKey | YRDGKMJXISQEIA-ZIAGYGMSSA-N |
| XLogP | 1.30 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|