About 4-[(R)-(2,5-difluorophenyl)-fluoromethyl]piperidine;hydrochloride
4-[(R)-(2,5-difluorophenyl)-fluoromethyl]piperidine;hydrochloride (PubChem CID 90039406) has the molecular formula C12H15ClF3N
and a molecular weight of 265.71 g/mol. Its IUPAC name is 4-[(R)-(2,5-difluorophenyl)-fluoromethyl]piperidine;hydrochloride.
Molecular Properties
| Compound Name | 4-[(R)-(2,5-difluorophenyl)-fluoromethyl]piperidine;hydrochloride |
| PubChem CID | 90039406 |
| Molecular Formula | C12H15ClF3N |
| Molecular Weight | 265.71 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 4-[(R)-(2,5-difluorophenyl)-fluoromethyl]piperidine;hydrochloride |
| SMILES | Cl.Fc1ccc(F)c([C@H](F)C2CCNCC2)c1 |
| InChI | InChI=1S/C12H14F3N.ClH/c13-9-1-2-11(14)10(7-9)12(15)8-3-5-16-6-4-8;/h1-2,7-8,12,16H,3-6H2;1H/t12-;/m1./s1 |
| InChIKey | LXVWOTJFXBYOTJ-UTONKHPSSA-N |
| XLogP | 3.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.71 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(R)-(2,5-difluorophenyl)-fluoromethyl]piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(R)-(2,5-difluorophenyl)-fluoromethyl]piperidine;hydrochloride?
The IUPAC name of 4-[(R)-(2,5-difluorophenyl)-fluoromethyl]piperidine;hydrochloride (CID 90039406) is 4-[(R)-(2,5-difluorophenyl)-fluoromethyl]piperidine;hydrochloride.
What is the SMILES notation for 4-[(R)-(2,5-difluorophenyl)-fluoromethyl]piperidine;hydrochloride?
The canonical SMILES for 4-[(R)-(2,5-difluorophenyl)-fluoromethyl]piperidine;hydrochloride is Cl.Fc1ccc(F)c([C@H](F)C2CCNCC2)c1.
What is the InChIKey of 4-[(R)-(2,5-difluorophenyl)-fluoromethyl]piperidine;hydrochloride?
The InChIKey is LXVWOTJFXBYOTJ-UTONKHPSSA-N. The full InChI is InChI=1S/C12H14F3N.ClH/c13-9-1-2-11(14)10(7-9)12(15)8-3-5-16-6-4-8;/h1-2,7-8,12,16H,3-6H2;1H/t12-;/m1./s1.
What are the key properties of 4-[(R)-(2,5-difluorophenyl)-fluoromethyl]piperidine;hydrochloride?
4-[(R)-(2,5-difluorophenyl)-fluoromethyl]piperidine;hydrochloride has a molecular weight of 265.71 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(R)-(2,5-difluorophenyl)-fluoromethyl]piperidine;hydrochloride is sourced from PubChem (CID 90039406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).