About 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(3-methoxypropyl)quinoxalin-2-amine
3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(3-methoxypropyl)quinoxalin-2-amine (PubChem CID 90039415) has the molecular formula C23H27Cl2N5O
and a molecular weight of 460.41 g/mol. Its IUPAC name is 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(3-methoxypropyl)quinoxalin-2-amine.
Molecular Properties
| Compound Name | 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(3-methoxypropyl)quinoxalin-2-amine |
| PubChem CID | 90039415 |
| Molecular Formula | C23H27Cl2N5O |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(3-methoxypropyl)quinoxalin-2-amine |
| SMILES | COCCCNc1nc2ccccc2nc1N1CCN(Cc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C23H27Cl2N5O/c1-31-14-4-9-26-22-23(28-21-6-3-2-5-20(21)27-22)30-12-10-29(11-13-30)16-17-15-18(24)7-8-19(17)25/h2-3,5-8,15H,4,9-14,16H2,1H3,(H,26,27) |
| InChIKey | MLQCFXZOYASPKM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(3-methoxypropyl)quinoxalin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(3-methoxypropyl)quinoxalin-2-amine?
The IUPAC name of 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(3-methoxypropyl)quinoxalin-2-amine (CID 90039415) is 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(3-methoxypropyl)quinoxalin-2-amine.
What is the SMILES notation for 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(3-methoxypropyl)quinoxalin-2-amine?
The canonical SMILES for 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(3-methoxypropyl)quinoxalin-2-amine is COCCCNc1nc2ccccc2nc1N1CCN(Cc2cc(Cl)ccc2Cl)CC1.
What is the InChIKey of 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(3-methoxypropyl)quinoxalin-2-amine?
The InChIKey is MLQCFXZOYASPKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27Cl2N5O/c1-31-14-4-9-26-22-23(28-21-6-3-2-5-20(21)27-22)30-12-10-29(11-13-30)16-17-15-18(24)7-8-19(17)25/h2-3,5-8,15H,4,9-14,16H2,1H3,(H,26,27).
What are the key properties of 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(3-methoxypropyl)quinoxalin-2-amine?
3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(3-methoxypropyl)quinoxalin-2-amine has a molecular weight of 460.41 g/mol, XLogP of 4.71, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(3-methoxypropyl)quinoxalin-2-amine is sourced from PubChem (CID 90039415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).