About 3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenyl-1-prop-2-enylurea
3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenyl-1-prop-2-enylurea (PubChem CID 900396) has the molecular formula C18H17N3O2
and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenyl-1-prop-2-enylurea.
Molecular Properties
| Compound Name | 3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenyl-1-prop-2-enylurea |
| PubChem CID | 900396 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenyl-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)Nc1ccc2oc(C)nc2c1)c1ccccc1 |
| InChI | InChI=1S/C18H17N3O2/c1-3-11-21(15-7-5-4-6-8-15)18(22)20-14-9-10-17-16(12-14)19-13(2)23-17/h3-10,12H,1,11H2,2H3,(H,20,22) |
| InChIKey | XQWOFMZOCCGSDQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenyl-1-prop-2-enylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenyl-1-prop-2-enylurea?
The IUPAC name of 3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenyl-1-prop-2-enylurea (CID 900396) is 3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenyl-1-prop-2-enylurea.
What is the SMILES notation for 3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenyl-1-prop-2-enylurea?
The canonical SMILES for 3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenyl-1-prop-2-enylurea is C=CCN(C(=O)Nc1ccc2oc(C)nc2c1)c1ccccc1.
What is the InChIKey of 3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenyl-1-prop-2-enylurea?
The InChIKey is XQWOFMZOCCGSDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2/c1-3-11-21(15-7-5-4-6-8-15)18(22)20-14-9-10-17-16(12-14)19-13(2)23-17/h3-10,12H,1,11H2,2H3,(H,20,22).
What are the key properties of 3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenyl-1-prop-2-enylurea?
3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenyl-1-prop-2-enylurea has a molecular weight of 307.35 g/mol, XLogP of 4.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenyl-1-prop-2-enylurea is sourced from PubChem (CID 900396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).